C32H24CoN4O2S2 — CID 5225465
cobalt;bis(2-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol) (PubChem CID 5225465) has the molecular formula C32H24CoN4O2S2 and a molecular weight of 619.64 g/mol. Its IUPAC name is cobalt;bis(2-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol).
| Compound Name | cobalt;bis(2-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol) |
|---|---|
| PubChem CID | 5225465 |
| Molecular Formula | C32H24CoN4O2S2 |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | cobalt;bis(2-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol) |
| SMILES | Oc1ccccc1C=Nc1nc(-c2ccccc2)cs1.Oc1ccccc1C=Nc1nc(-c2ccccc2)cs1.[Co] |
| InChI | InChI=1S/2C16H12N2OS.Co/c2*19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12;/h2*1-11,19H; |
| InChIKey | BQCIUVWTXVHVOV-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|