C32H22N4NiO2S2 — CID 170905301
nickel(2+);bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenolate) (PubChem CID 170905301) has the molecular formula C32H22N4NiO2S2 and a molecular weight of 617.38 g/mol. Its IUPAC name is nickel(2+);bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenolate).
| Compound Name | nickel(2+);bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenolate) |
|---|---|
| PubChem CID | 170905301 |
| Molecular Formula | C32H22N4NiO2S2 |
| Molecular Weight | 617.38 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | nickel(2+);bis(2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenolate) |
| SMILES | [Ni+2].[O-]c1ccccc1/C=N/c1nc(-c2ccccc2)cs1.[O-]c1ccccc1/C=N/c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/2C16H12N2OS.Ni/c2*19-15-9-5-4-8-13(15)10-17-16-18-14(11-20-16)12-6-2-1-3-7-12;/h2*1-11,19H;/q;;+2/p-2/b2*17-10+; |
| InChIKey | JEPVZRUUYYAAEN-WVWZWRPUSA-L |
| XLogP | 7.27 |
| TPSA | 96.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.38 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|