C19H14N2O4S — CID 1253244
8-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]-4H-1,3-benzodioxine-6-carboxylic acid (PubChem CID 1253244) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 8-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]-4H-1,3-benzodioxine-6-carboxylic acid.
| Compound Name | 8-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]-4H-1,3-benzodioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 1253244 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 8-[(4-phenyl-1,3-thiazol-2-yl)iminomethyl]-4H-1,3-benzodioxine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(C=Nc2nc(-c3ccccc3)cs2)c2c(c1)COCO2 |
| InChI | InChI=1S/C19H14N2O4S/c22-18(23)13-6-14(17-15(7-13)9-24-11-25-17)8-20-19-21-16(10-26-19)12-4-2-1-3-5-12/h1-8,10H,9,11H2,(H,22,23) |
| InChIKey | GNRDBIOLIKGBDS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|