C16H11N3O3S — CID 135505166
4-nitro-2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol (PubChem CID 135505166) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-nitro-2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol.
| Compound Name | 4-nitro-2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135505166 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-nitro-2-[(E)-(4-phenyl-1,3-thiazol-2-yl)iminomethyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C16H11N3O3S/c20-15-7-6-13(19(21)22)8-12(15)9-17-16-18-14(10-23-16)11-4-2-1-3-5-11/h1-10,20H/b17-9+ |
| InChIKey | WEHOGRSUNLNPPI-RQZCQDPDSA-N |
| XLogP | 4.17 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|