C23H12ClN5O4S — CID 25019254
(E)-N-[4-(9-chloro-7-nitroacridin-2-yl)-1,3-thiazol-2-yl]-1-(3-nitrophenyl)methanimine (PubChem CID 25019254) has the molecular formula C23H12ClN5O4S and a molecular weight of 489.90 g/mol. Its IUPAC name is (E)-N-[4-(9-chloro-7-nitroacridin-2-yl)-1,3-thiazol-2-yl]-1-(3-nitrophenyl)methanimine.
| Compound Name | (E)-N-[4-(9-chloro-7-nitroacridin-2-yl)-1,3-thiazol-2-yl]-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 25019254 |
| Molecular Formula | C23H12ClN5O4S |
| Molecular Weight | 489.90 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | (E)-N-[4-(9-chloro-7-nitroacridin-2-yl)-1,3-thiazol-2-yl]-1-(3-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2nc(-c3ccc4nc5ccc([N+](=O)[O-])cc5c(Cl)c4c3)cs2)c1 |
| InChI | InChI=1S/C23H12ClN5O4S/c24-22-17-9-14(4-6-19(17)26-20-7-5-16(29(32)33)10-18(20)22)21-12-34-23(27-21)25-11-13-2-1-3-15(8-13)28(30)31/h1-12H/b25-11+ |
| InChIKey | JGSDAUSRXNPPAM-OPEKNORGSA-N |
| XLogP | 6.73 |
| TPSA | 124.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.90 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|