C18H17ClN3O4S- — CID 135450438
3-hydroxy-5,5-dimethyl-2-[(E)-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]iminomethyl]cyclohex-2-en-1-one chloride (PubChem CID 135450438) has the molecular formula C18H17ClN3O4S- and a molecular weight of 406.87 g/mol. Its IUPAC name is 3-hydroxy-5,5-dimethyl-2-[(E)-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]iminomethyl]cyclohex-2-en-1-one chloride.
| Compound Name | 3-hydroxy-5,5-dimethyl-2-[(E)-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]iminomethyl]cyclohex-2-en-1-one chloride |
|---|---|
| PubChem CID | 135450438 |
| Molecular Formula | C18H17ClN3O4S- |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-hydroxy-5,5-dimethyl-2-[(E)-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]iminomethyl]cyclohex-2-en-1-one chloride |
| SMILES | CC1(C)CC(=O)C(/C=N/c2nc(-c3cccc([N+](=O)[O-])c3)cs2)=C(O)C1.[Cl-] |
| InChI | InChI=1S/C18H17N3O4S.ClH/c1-18(2)7-15(22)13(16(23)8-18)9-19-17-20-14(10-26-17)11-4-3-5-12(6-11)21(24)25;/h3-6,9-10,22H,7-8H2,1-2H3;1H/p-1/b19-9+; |
| InChIKey | RVXCKDDAWQYTHT-MYHMWQFYSA-M |
| XLogP | 1.63 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|