C15H11N5O2S — CID 91930693
[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-(pyridin-2-ylmethyl)diazene (PubChem CID 91930693) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is [4-(3-nitrophenyl)-1,3-thiazol-2-yl]-(pyridin-2-ylmethyl)diazene.
| Compound Name | [4-(3-nitrophenyl)-1,3-thiazol-2-yl]-(pyridin-2-ylmethyl)diazene |
|---|---|
| PubChem CID | 91930693 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | [4-(3-nitrophenyl)-1,3-thiazol-2-yl]-(pyridin-2-ylmethyl)diazene |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(/N=N/Cc3ccccn3)n2)c1 |
| InChI | InChI=1S/C15H11N5O2S/c21-20(22)13-6-3-4-11(8-13)14-10-23-15(18-14)19-17-9-12-5-1-2-7-16-12/h1-8,10H,9H2/b19-17+ |
| InChIKey | DLYXBEAIFXAIHS-HTXNQAPBSA-N |
| XLogP | 4.40 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|