C16H10BrClN4O2S — CID 91426578
[4-(4-bromophenyl)-1,3-thiazol-2-yl]-[(4-chloro-3-nitrophenyl)methyl]diazene (PubChem CID 91426578) has the molecular formula C16H10BrClN4O2S and a molecular weight of 437.71 g/mol. Its IUPAC name is [4-(4-bromophenyl)-1,3-thiazol-2-yl]-[(4-chloro-3-nitrophenyl)methyl]diazene.
| Compound Name | [4-(4-bromophenyl)-1,3-thiazol-2-yl]-[(4-chloro-3-nitrophenyl)methyl]diazene |
|---|---|
| PubChem CID | 91426578 |
| Molecular Formula | C16H10BrClN4O2S |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | [4-(4-bromophenyl)-1,3-thiazol-2-yl]-[(4-chloro-3-nitrophenyl)methyl]diazene |
| SMILES | O=[N+]([O-])c1cc(C/N=N/c2nc(-c3ccc(Br)cc3)cs2)ccc1Cl |
| InChI | InChI=1S/C16H10BrClN4O2S/c17-12-4-2-11(3-5-12)14-9-25-16(20-14)21-19-8-10-1-6-13(18)15(7-10)22(23)24/h1-7,9H,8H2/b21-19+ |
| InChIKey | PBJIBQPYWPZUOP-XUTLUUPISA-N |
| XLogP | 6.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|