C16H12BrN3S — CID 91928514
benzyl-[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazene (PubChem CID 91928514) has the molecular formula C16H12BrN3S and a molecular weight of 358.26 g/mol. Its IUPAC name is benzyl-[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazene.
| Compound Name | benzyl-[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazene |
|---|---|
| PubChem CID | 91928514 |
| Molecular Formula | C16H12BrN3S |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | benzyl-[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazene |
| SMILES | Brc1ccc(-c2csc(/N=N/Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12BrN3S/c17-14-8-6-13(7-9-14)15-11-21-16(19-15)20-18-10-12-4-2-1-3-5-12/h1-9,11H,10H2/b20-18+ |
| InChIKey | IVWQOWMXEVHCSH-CZIZESTLSA-N |
| XLogP | 5.86 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|