C24H21N3O4S2 — CID 170922550
[2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)diazenyl]methyl]phenyl] benzenesulfonate (PubChem CID 170922550) has the molecular formula C24H21N3O4S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)diazenyl]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)diazenyl]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 170922550 |
| Molecular Formula | C24H21N3O4S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [2-ethoxy-4-[[(4-phenyl-1,3-thiazol-2-yl)diazenyl]methyl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(C/N=N/c2nc(-c3ccccc3)cs2)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21N3O4S2/c1-2-30-23-15-18(13-14-22(23)31-33(28,29)20-11-7-4-8-12-20)16-25-27-24-26-21(17-32-24)19-9-5-3-6-10-19/h3-15,17H,2,16H2,1H3/b27-25+ |
| InChIKey | AGSSDVSBXBEZOJ-IMVLJIQESA-N |
| XLogP | 6.26 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|