C14H15NO3S — CID 3744151
4-(3,4-diethoxyphenyl)-1,3-thiazole-2-carbaldehyde (PubChem CID 3744151) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is 4-(3,4-diethoxyphenyl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | 4-(3,4-diethoxyphenyl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 3744151 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-(3,4-diethoxyphenyl)-1,3-thiazole-2-carbaldehyde |
| SMILES | CCOc1ccc(-c2csc(C=O)n2)cc1OCC |
| InChI | InChI=1S/C14H15NO3S/c1-3-17-12-6-5-10(7-13(12)18-4-2)11-9-19-14(8-16)15-11/h5-9H,3-4H2,1-2H3 |
| InChIKey | FRPXNALTLCPMOU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|