C21H23N3O3S — CID 84565401
N-[3-[[4-(3,4-diethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide (PubChem CID 84565401) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[3-[[4-(3,4-diethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-(3,4-diethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 84565401 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[3-[[4-(3,4-diethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]acetamide |
| SMILES | CCOc1ccc(-c2csc(Nc3cccc(NC(C)=O)c3)n2)cc1OCC |
| InChI | InChI=1S/C21H23N3O3S/c1-4-26-19-10-9-15(11-20(19)27-5-2)18-13-28-21(24-18)23-17-8-6-7-16(12-17)22-14(3)25/h6-13H,4-5H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | RUAYQOFLGVYSOZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |