C18H15N2O4S- — CID 4224537
3-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzoate (PubChem CID 4224537) has the molecular formula C18H15N2O4S- and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzoate.
| Compound Name | 3-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 4224537 |
| Molecular Formula | C18H15N2O4S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]amino]benzoate |
| SMILES | COc1ccc(-c2csc(Nc3cccc(C(=O)[O-])c3)n2)cc1OC |
| InChI | InChI=1S/C18H16N2O4S/c1-23-15-7-6-11(9-16(15)24-2)14-10-25-18(20-14)19-13-5-3-4-12(8-13)17(21)22/h3-10H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | KTJYQBAKTQNGMV-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |