C17H12Cl2N2O2S — CID 84565454
methyl 3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]benzoate (PubChem CID 84565454) has the molecular formula C17H12Cl2N2O2S and a molecular weight of 379.27 g/mol. Its IUPAC name is methyl 3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]benzoate.
| Compound Name | methyl 3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 84565454 |
| Molecular Formula | C17H12Cl2N2O2S |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | methyl 3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)c1 |
| InChI | InChI=1S/C17H12Cl2N2O2S/c1-23-16(22)11-3-2-4-12(7-11)20-17-21-15(9-24-17)10-5-6-13(18)14(19)8-10/h2-9H,1H3,(H,20,21) |
| InChIKey | YUKFWAMUBUWFQD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |