C28H27Cl2N3O4S — CID 88647064
diethyl 4-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88647064) has the molecular formula C28H27Cl2N3O4S and a molecular weight of 572.51 g/mol. Its IUPAC name is diethyl 4-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88647064 |
| Molecular Formula | C28H27Cl2N3O4S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | diethyl 4-[3-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cccc(Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)c1 |
| InChI | InChI=1S/C28H27Cl2N3O4S/c1-5-36-26(34)23-15(3)31-16(4)24(27(35)37-6-2)25(23)18-8-7-9-19(12-18)32-28-33-22(14-38-28)17-10-11-20(29)21(30)13-17/h7-14,25,31H,5-6H2,1-4H3,(H,32,33) |
| InChIKey | OODGIXVAGMRIOL-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |