C29H31N3O7S — CID 88647385
dimethyl 2,6-dimethyl-4-[3-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88647385) has the molecular formula C29H31N3O7S and a molecular weight of 565.65 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[3-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[3-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88647385 |
| Molecular Formula | C29H31N3O7S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[3-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(Nc2nc(-c3cc(OC)c(OC)c(OC)c3)cs2)c1 |
| InChI | InChI=1S/C29H31N3O7S/c1-15-23(27(33)38-6)25(24(16(2)30-15)28(34)39-7)17-9-8-10-19(11-17)31-29-32-20(14-40-29)18-12-21(35-3)26(37-5)22(13-18)36-4/h8-14,25,30H,1-7H3,(H,31,32) |
| InChIKey | VFPCXGZGHBSLHV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |