C29H30N2O7S — CID 54027591
dimethyl 2,6-dimethyl-4-[3-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54027591) has the molecular formula C29H30N2O7S and a molecular weight of 550.63 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[3-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[3-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54027591 |
| Molecular Formula | C29H30N2O7S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[3-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)N=C(C)C(C(=O)OC)C1c1cccc(-c2nc(-c3cc(OC)c(OC)c(OC)c3)cs2)c1 |
| InChI | InChI=1S/C29H30N2O7S/c1-15-23(28(32)37-6)25(24(16(2)30-15)29(33)38-7)17-9-8-10-18(11-17)27-31-20(14-39-27)19-12-21(34-3)26(36-5)22(13-19)35-4/h8-14,23,25H,1-7H3 |
| InChIKey | LDHYGRIPFABCRJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |