C31H34N2O4S — CID 54540546
diethyl 2,6-dimethyl-4-[3-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54540546) has the molecular formula C31H34N2O4S and a molecular weight of 530.69 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-[3-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-4-[3-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54540546 |
| Molecular Formula | C31H34N2O4S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | diethyl 2,6-dimethyl-4-[3-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)C1c1cccc(-c2nc(-c3c(C)cc(C)cc3C)cs2)c1 |
| InChI | InChI=1S/C31H34N2O4S/c1-8-36-30(34)26-20(6)32-21(7)27(31(35)37-9-2)28(26)22-11-10-12-23(15-22)29-33-24(16-38-29)25-18(4)13-17(3)14-19(25)5/h10-16,26,28H,8-9H2,1-7H3 |
| InChIKey | ZCWKSMWWGYYVCV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 77.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |