C19H24N2O5 — CID 54224436
diethyl 2,6-dimethyl-4-(6-methyl-1-oxidopyridin-1-ium-2-yl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54224436) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-4-(6-methyl-1-oxidopyridin-1-ium-2-yl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-4-(6-methyl-1-oxidopyridin-1-ium-2-yl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54224436 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | diethyl 2,6-dimethyl-4-(6-methyl-1-oxidopyridin-1-ium-2-yl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)C1c1cccc(C)[n+]1[O-] |
| InChI | InChI=1S/C19H24N2O5/c1-6-25-18(22)15-12(4)20-13(5)16(19(23)26-7-2)17(15)14-10-8-9-11(3)21(14)24/h8-10,15,17H,6-7H2,1-5H3 |
| InChIKey | QEWHHVBJNNQYII-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|