C28H29N3O6S — CID 54385782
diethyl 4-[2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54385782) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is diethyl 4-[2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-[2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54385782 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | diethyl 4-[2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]phenyl]-2,6-dimethyl-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N=C(C)C(C(=O)OCC)C1c1ccccc1Nc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C28H29N3O6S/c1-5-36-26(34)23-15(3)29-16(4)24(27(35)37-6-2)25(23)18-9-7-8-10-19(18)30-28-31-20(14-38-28)17-11-12-21(32)22(33)13-17/h7-14,23,25,32-33H,5-6H2,1-4H3,(H,30,31) |
| InChIKey | VDDDIEVCLZUWCZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|