C18H14Cl2N2O2S — CID 1477046
ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]benzoate (PubChem CID 1477046) has the molecular formula C18H14Cl2N2O2S and a molecular weight of 393.30 g/mol. Its IUPAC name is ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]benzoate.
| Compound Name | ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]benzoate |
|---|---|
| PubChem CID | 1477046 |
| Molecular Formula | C18H14Cl2N2O2S |
| Molecular Weight | 393.30 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | ethyl 2-[2-(3,4-dichloroanilino)-1,3-thiazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1csc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H14Cl2N2O2S/c1-2-24-17(23)13-6-4-3-5-12(13)16-10-25-18(22-16)21-11-7-8-14(19)15(20)9-11/h3-10H,2H2,1H3,(H,21,22) |
| InChIKey | YUGZCIFBTDNZNA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.30 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |