C16H12Cl2N2OS — CID 5168594
N-(3,4-dichlorophenyl)-4-(2-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 5168594) has the molecular formula C16H12Cl2N2OS and a molecular weight of 351.26 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(2-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3,4-dichlorophenyl)-4-(2-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 5168594 |
| Molecular Formula | C16H12Cl2N2OS |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(2-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccccc1-c1csc(Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H12Cl2N2OS/c1-21-15-5-3-2-4-11(15)14-9-22-16(20-14)19-10-6-7-12(17)13(18)8-10/h2-9H,1H3,(H,19,20) |
| InChIKey | XDGIOQWFZUPZHT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |