C21H15ClN2OS — CID 58791971
4-(2-chlorophenyl)-N-(3-phenoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 58791971) has the molecular formula C21H15ClN2OS and a molecular weight of 378.88 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N-(3-phenoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2-chlorophenyl)-N-(3-phenoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791971 |
| Molecular Formula | C21H15ClN2OS |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 4-(2-chlorophenyl)-N-(3-phenoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccccc1-c1csc(Nc2cccc(Oc3ccccc3)c2)n1 |
| InChI | InChI=1S/C21H15ClN2OS/c22-19-12-5-4-11-18(19)20-14-26-21(24-20)23-15-7-6-10-17(13-15)25-16-8-2-1-3-9-16/h1-14H,(H,23,24) |
| InChIKey | XTKNHNKVLZTYDM-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |