C17H16ClN3S — CID 53338296
1-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 53338296) has the molecular formula C17H16ClN3S and a molecular weight of 329.86 g/mol. Its IUPAC name is 1-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 53338296 |
| Molecular Formula | C17H16ClN3S |
| Molecular Weight | 329.86 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2nc(-c3ccccc3Cl)cs2)cc1 |
| InChI | InChI=1S/C17H16ClN3S/c1-21(2)13-9-7-12(8-10-13)19-17-20-16(11-22-17)14-5-3-4-6-15(14)18/h3-11H,1-2H3,(H,19,20) |
| InChIKey | PXYFHWWLSLHIMC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|