C16H15ClN4S — CID 166340336
N-(6-chloro-3-pyridinyl)-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine (PubChem CID 166340336) has the molecular formula C16H15ClN4S and a molecular weight of 330.84 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 166340336 |
| Molecular Formula | C16H15ClN4S |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-[4-(dimethylamino)phenyl]-1,3-thiazol-2-amine |
| SMILES | CN(C)c1ccc(-c2csc(Nc3ccc(Cl)nc3)n2)cc1 |
| InChI | InChI=1S/C16H15ClN4S/c1-21(2)13-6-3-11(4-7-13)14-10-22-16(20-14)19-12-5-8-15(17)18-9-12/h3-10H,1-2H3,(H,19,20) |
| InChIKey | FEQJPIXHTDFAJN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|