C17H17ClN4O2S2 — CID 166184350
N-[4-[2-[(6-chloro-3-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide (PubChem CID 166184350) has the molecular formula C17H17ClN4O2S2 and a molecular weight of 408.94 g/mol. Its IUPAC name is N-[4-[2-[(6-chloro-3-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[4-[2-[(6-chloro-3-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 166184350 |
| Molecular Formula | C17H17ClN4O2S2 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-[4-[2-[(6-chloro-3-pyridinyl)amino]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(c1ccc(-c2csc(Nc3ccc(Cl)nc3)n2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H17ClN4O2S2/c1-3-22(26(2,23)24)14-7-4-12(5-8-14)15-11-25-17(21-15)20-13-6-9-16(18)19-10-13/h4-11H,3H2,1-2H3,(H,20,21) |
| InChIKey | UPNNJVBTVOECQV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|