C20H23N3O2S2 — CID 9173901
N-[4-[2-[4-(dimethylamino)phenyl]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide (PubChem CID 9173901) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[4-[2-[4-(dimethylamino)phenyl]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[4-[2-[4-(dimethylamino)phenyl]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 9173901 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[4-[2-[4-(dimethylamino)phenyl]-1,3-thiazol-4-yl]phenyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(c1ccc(-c2csc(-c3ccc(N(C)C)cc3)n2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H23N3O2S2/c1-5-23(27(4,24)25)18-12-6-15(7-13-18)19-14-26-20(21-19)16-8-10-17(11-9-16)22(2)3/h6-14H,5H2,1-4H3 |
| InChIKey | KGLGFTCULYAQRC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|