C24H26N4O2S2 — CID 53104381
N-[[4-(dimethylamino)phenyl]methyl]-1,2-dimethyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide (PubChem CID 53104381) has the molecular formula C24H26N4O2S2 and a molecular weight of 466.63 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1,2-dimethyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1,2-dimethyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 53104381 |
| Molecular Formula | C24H26N4O2S2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1,2-dimethyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCc2ccc(N(C)C)cc2)cc(-c2nc(-c3ccccc3)cs2)n1C |
| InChI | InChI=1S/C24H26N4O2S2/c1-17-23(32(29,30)25-15-18-10-12-20(13-11-18)27(2)3)14-22(28(17)4)24-26-21(16-31-24)19-8-6-5-7-9-19/h5-14,16,25H,15H2,1-4H3 |
| InChIKey | DKAACEXTNFIOAA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|