C21H19N3O2S2 — CID 53035430
1,2-dimethyl-N-phenyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide (PubChem CID 53035430) has the molecular formula C21H19N3O2S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 1,2-dimethyl-N-phenyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide.
| Compound Name | 1,2-dimethyl-N-phenyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 53035430 |
| Molecular Formula | C21H19N3O2S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1,2-dimethyl-N-phenyl-5-(4-phenyl-1,3-thiazol-2-yl)pyrrole-3-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)Nc2ccccc2)cc(-c2nc(-c3ccccc3)cs2)n1C |
| InChI | InChI=1S/C21H19N3O2S2/c1-15-20(28(25,26)23-17-11-7-4-8-12-17)13-19(24(15)2)21-22-18(14-27-21)16-9-5-3-6-10-16/h3-14,23H,1-2H3 |
| InChIKey | KTPDLRAQLUNFFX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |