C22H27ClN4O3S2 — CID 53104391
5-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,2-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrole-3-sulfonamide (PubChem CID 53104391) has the molecular formula C22H27ClN4O3S2 and a molecular weight of 495.07 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,2-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrole-3-sulfonamide.
| Compound Name | 5-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,2-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 53104391 |
| Molecular Formula | C22H27ClN4O3S2 |
| Molecular Weight | 495.07 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-1,2-dimethyl-N-(3-morpholin-4-ylpropyl)pyrrole-3-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCN2CCOCC2)cc(-c2nc(-c3ccc(Cl)cc3)cs2)n1C |
| InChI | InChI=1S/C22H27ClN4O3S2/c1-16-21(32(28,29)24-8-3-9-27-10-12-30-13-11-27)14-20(26(16)2)22-25-19(15-31-22)17-4-6-18(23)7-5-17/h4-7,14-15,24H,3,8-13H2,1-2H3 |
| InChIKey | NTVIOXNAWAXRCE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.07 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|