C14H9Cl2N3S — CID 166340316
4-(4-chlorophenyl)-N-(6-chloro-3-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 166340316) has the molecular formula C14H9Cl2N3S and a molecular weight of 322.22 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(6-chloro-3-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-(6-chloro-3-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 166340316 |
| Molecular Formula | C14H9Cl2N3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(6-chloro-3-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(Nc3ccc(Cl)nc3)n2)cc1 |
| InChI | InChI=1S/C14H9Cl2N3S/c15-10-3-1-9(2-4-10)12-8-20-14(19-12)18-11-5-6-13(16)17-7-11/h1-8H,(H,18,19) |
| InChIKey | FDVHZSXVOYAJEO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|