C17H15ClN4O2S2 — CID 167841857
N-(6-chloro-3-pyridinyl)-4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-amine (PubChem CID 167841857) has the molecular formula C17H15ClN4O2S2 and a molecular weight of 406.92 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(6-chloro-3-pyridinyl)-4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167841857 |
| Molecular Formula | C17H15ClN4O2S2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-1,3-thiazol-2-amine |
| SMILES | CS(=O)(=O)N1CCc2cc(-c3csc(Nc4ccc(Cl)nc4)n3)ccc21 |
| InChI | InChI=1S/C17H15ClN4O2S2/c1-26(23,24)22-7-6-12-8-11(2-4-15(12)22)14-10-25-17(21-14)20-13-3-5-16(18)19-9-13/h2-5,8-10H,6-7H2,1H3,(H,20,21) |
| InChIKey | PCJOLVGBOFZADK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|