About 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole
4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole (PubChem CID 31263057) has the molecular formula C17H15N3O2S2
and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole |
| PubChem CID | 31263057 |
| Molecular Formula | C17H15N3O2S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole |
| SMILES | CS(=O)(=O)N1CCc2cc(-c3csc(-c4ccncc4)n3)ccc21 |
| InChI | InChI=1S/C17H15N3O2S2/c1-24(21,22)20-9-6-14-10-13(2-3-16(14)20)15-11-23-17(19-15)12-4-7-18-8-5-12/h2-5,7-8,10-11H,6,9H2,1H3 |
| InChIKey | DPAQIJFJPWYKPK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole?
The IUPAC name of 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole (CID 31263057) is 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole.
What is the SMILES notation for 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole?
The canonical SMILES for 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole is CS(=O)(=O)N1CCc2cc(-c3csc(-c4ccncc4)n3)ccc21.
What is the InChIKey of 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole?
The InChIKey is DPAQIJFJPWYKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O2S2/c1-24(21,22)20-9-6-14-10-13(2-3-16(14)20)15-11-23-17(19-15)12-4-7-18-8-5-12/h2-5,7-8,10-11H,6,9H2,1H3.
What are the key properties of 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole?
4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole has a molecular weight of 357.46 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-methylsulfonyl-2,3-dihydroindol-5-yl)-2-pyridin-4-yl-1,3-thiazole is sourced from PubChem (CID 31263057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).