C19H21N3OS — CID 23889665
1-N-[4-(4-methoxy-3-methylphenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 23889665) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-N-[4-(4-methoxy-3-methylphenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[4-(4-methoxy-3-methylphenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 23889665 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-N-[4-(4-methoxy-3-methylphenyl)-1,3-thiazol-2-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | COc1ccc(-c2csc(Nc3ccc(N(C)C)cc3)n2)cc1C |
| InChI | InChI=1S/C19H21N3OS/c1-13-11-14(5-10-18(13)23-4)17-12-24-19(21-17)20-15-6-8-16(9-7-15)22(2)3/h5-12H,1-4H3,(H,20,21) |
| InChIKey | RGJQWAZFQRTWAL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|