C28H31N5O2S — CID 3591415
N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 3591415) has the molecular formula C28H31N5O2S and a molecular weight of 501.66 g/mol. Its IUPAC name is N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3591415 |
| Molecular Formula | C28H31N5O2S |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-[bis[4-(dimethylamino)phenyl]methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2csc(NN=C(c3ccc(N(C)C)cc3)c3ccc(N(C)C)cc3)n2)cc1OC |
| InChI | InChI=1S/C28H31N5O2S/c1-32(2)22-12-7-19(8-13-22)27(20-9-14-23(15-10-20)33(3)4)30-31-28-29-24(18-36-28)21-11-16-25(34-5)26(17-21)35-6/h7-18H,1-6H3,(H,29,31) |
| InChIKey | WJMXEWJVVIGTNE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|