C22H16Cl2N2OS — CID 58791226
4-(3,4-dichlorophenyl)-N-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 58791226) has the molecular formula C22H16Cl2N2OS and a molecular weight of 427.36 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791226 |
| Molecular Formula | C22H16Cl2N2OS |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(3-phenylmethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(-c2csc(Nc3cccc(OCc4ccccc4)c3)n2)cc1Cl |
| InChI | InChI=1S/C22H16Cl2N2OS/c23-19-10-9-16(11-20(19)24)21-14-28-22(26-21)25-17-7-4-8-18(12-17)27-13-15-5-2-1-3-6-15/h1-12,14H,13H2,(H,25,26) |
| InChIKey | DJWACNNBCIPEHC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |