C28H21N3O3S — CID 110492775
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-phenylmethoxybenzoate (PubChem CID 110492775) has the molecular formula C28H21N3O3S and a molecular weight of 479.56 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-phenylmethoxybenzoate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 110492775 |
| Molecular Formula | C28H21N3O3S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 4-phenylmethoxybenzoate |
| SMILES | O=C(Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N3O3S/c32-27(21-12-14-23(15-13-21)33-18-20-7-2-1-3-8-20)34-24-10-6-9-22(17-24)30-28-31-26(19-35-28)25-11-4-5-16-29-25/h1-17,19H,18H2,(H,30,31) |
| InChIKey | PTGSWQMOEWSNIV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|