C23H16FN3O2S — CID 110492802
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 110492802) has the molecular formula C23H16FN3O2S and a molecular weight of 417.47 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 110492802 |
| Molecular Formula | C23H16FN3O2S |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(F)c1)Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C23H16FN3O2S/c24-17-6-3-5-16(13-17)10-11-22(28)29-19-8-4-7-18(14-19)26-23-27-21(15-30-23)20-9-1-2-12-25-20/h1-15H,(H,26,27)/b11-10+ |
| InChIKey | FHLOYGSJETXTOJ-ZHACJKMWSA-N |
| XLogP | 5.71 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|