C29H23N3O2S — CID 110492688
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,3-diphenylpropanoate (PubChem CID 110492688) has the molecular formula C29H23N3O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,3-diphenylpropanoate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 110492688 |
| Molecular Formula | C29H23N3O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,3-diphenylpropanoate |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C29H23N3O2S/c33-28(19-25(21-10-3-1-4-11-21)22-12-5-2-6-13-22)34-24-15-9-14-23(18-24)31-29-32-27(20-35-29)26-16-7-8-17-30-26/h1-18,20,25H,19H2,(H,31,32) |
| InChIKey | AXYVVTZGHGWZFU-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|