C19H19N3O3S — CID 110492783
tert-butyl [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] carbonate (PubChem CID 110492783) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is tert-butyl [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] carbonate.
| Compound Name | tert-butyl [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] carbonate |
|---|---|
| PubChem CID | 110492783 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | tert-butyl [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C19H19N3O3S/c1-19(2,3)25-18(23)24-14-8-6-7-13(11-14)21-17-22-16(12-26-17)15-9-4-5-10-20-15/h4-12H,1-3H3,(H,21,22) |
| InChIKey | AKEHWWYNPDYOKR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|