C22H15N3O4S — CID 110492710
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 1,3-benzodioxole-5-carboxylate (PubChem CID 110492710) has the molecular formula C22H15N3O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 110492710 |
| Molecular Formula | C22H15N3O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H15N3O4S/c26-21(14-7-8-19-20(10-14)28-13-27-19)29-16-5-3-4-15(11-16)24-22-25-18(12-30-22)17-6-1-2-9-23-17/h1-12H,13H2,(H,24,25) |
| InChIKey | JAGWSADEENKOPG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|