pyridin-2-yl 1,3-benzodioxole-5-carboxylate

C13H9NO4 — CID 35207859

IUPACpyridin-2-yl 1,3-benzodioxole-5-carboxylate
SMILESO=C(Oc1ccccn1)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H9NO4/c15-13(18-12-3-1-2-6-14-12)9-4-5-10-11(7-9)17-8-16-10/h1-7H,8H2
InChIKeyAIDVOAWZBBAEHR-UHFFFAOYSA-N
MW243.22 g/mol
LogP2.03
Rot. Bonds2

About pyridin-2-yl 1,3-benzodioxole-5-carboxylate

pyridin-2-yl 1,3-benzodioxole-5-carboxylate (PubChem CID 35207859) has the molecular formula C13H9NO4 and a molecular weight of 243.22 g/mol. Its IUPAC name is pyridin-2-yl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Namepyridin-2-yl 1,3-benzodioxole-5-carboxylate
PubChem CID35207859
Molecular FormulaC13H9NO4
Molecular Weight243.22 g/mol
Exact Mass243.05
IUPAC Namepyridin-2-yl 1,3-benzodioxole-5-carboxylate
SMILESO=C(Oc1ccccn1)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H9NO4/c15-13(18-12-3-1-2-6-14-12)9-4-5-10-11(7-9)17-8-16-10/h1-7H,8H2
InChIKeyAIDVOAWZBBAEHR-UHFFFAOYSA-N
XLogP2.03
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.22
LogP ≤ 52.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze pyridin-2-yl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyridin-2-yl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of pyridin-2-yl 1,3-benzodioxole-5-carboxylate (CID 35207859) is pyridin-2-yl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for pyridin-2-yl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for pyridin-2-yl 1,3-benzodioxole-5-carboxylate is O=C(Oc1ccccn1)c1ccc2c(c1)OCO2.
What is the InChIKey of pyridin-2-yl 1,3-benzodioxole-5-carboxylate?
The InChIKey is AIDVOAWZBBAEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO4/c15-13(18-12-3-1-2-6-14-12)9-4-5-10-11(7-9)17-8-16-10/h1-7H,8H2.
What are the key properties of pyridin-2-yl 1,3-benzodioxole-5-carboxylate?
pyridin-2-yl 1,3-benzodioxole-5-carboxylate has a molecular weight of 243.22 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 35207859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).