C12H10N4O4 — CID 18695258
(2,6-diaminopyrimidin-4-yl) 1,3-benzodioxole-5-carboxylate (PubChem CID 18695258) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is (2,6-diaminopyrimidin-4-yl) 1,3-benzodioxole-5-carboxylate.
| Compound Name | (2,6-diaminopyrimidin-4-yl) 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 18695258 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (2,6-diaminopyrimidin-4-yl) 1,3-benzodioxole-5-carboxylate |
| SMILES | Nc1cc(OC(=O)c2ccc3c(c2)OCO3)nc(N)n1 |
| InChI | InChI=1S/C12H10N4O4/c13-9-4-10(16-12(14)15-9)20-11(17)6-1-2-7-8(3-6)19-5-18-7/h1-4H,5H2,(H4,13,14,15,16) |
| InChIKey | HHMGVWUMWSHXOE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |