C22H16N2O4 — CID 123192443
(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate (PubChem CID 123192443) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate.
| Compound Name | (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 123192443 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate |
| SMILES | Cc1cc(C)c2nc3ccccc3nc2c1OC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H16N2O4/c1-12-9-13(2)21(20-19(12)23-15-5-3-4-6-16(15)24-20)28-22(25)14-7-8-17-18(10-14)27-11-26-17/h3-10H,11H2,1-2H3 |
| InChIKey | RNOCLPUIDOAQJB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|