(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate

C22H16N2O4 — CID 123192443

IUPAC(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate
SMILESCc1cc(C)c2nc3ccccc3nc2c1OC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C22H16N2O4/c1-12-9-13(2)21(20-19(12)23-15-5-3-4-6-16(15)24-20)28-22(25)14-7-8-17-18(10-14)27-11-26-17/h3-10H,11H2,1-2H3
InChIKeyRNOCLPUIDOAQJB-UHFFFAOYSA-N
MW372.38 g/mol
LogP4.35
Rot. Bonds2

About (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate

(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate (PubChem CID 123192443) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate
PubChem CID123192443
Molecular FormulaC22H16N2O4
Molecular Weight372.38 g/mol
Exact Mass372.11
IUPAC Name(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate
SMILESCc1cc(C)c2nc3ccccc3nc2c1OC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C22H16N2O4/c1-12-9-13(2)21(20-19(12)23-15-5-3-4-6-16(15)24-20)28-22(25)14-7-8-17-18(10-14)27-11-26-17/h3-10H,11H2,1-2H3
InChIKeyRNOCLPUIDOAQJB-UHFFFAOYSA-N
XLogP4.35
TPSA70.54 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.38
LogP ≤ 54.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate?
The IUPAC name of (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate (CID 123192443) is (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate is Cc1cc(C)c2nc3ccccc3nc2c1OC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate?
The InChIKey is RNOCLPUIDOAQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O4/c1-12-9-13(2)21(20-19(12)23-15-5-3-4-6-16(15)24-20)28-22(25)14-7-8-17-18(10-14)27-11-26-17/h3-10H,11H2,1-2H3.
What are the key properties of (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate?
(2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate has a molecular weight of 372.38 g/mol, XLogP of 4.35, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylphenazin-1-yl) 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 123192443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).