C19H13ClO4 — CID 7920028
(4-chloronaphthalen-1-yl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate (PubChem CID 7920028) has the molecular formula C19H13ClO4 and a molecular weight of 340.76 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate.
| Compound Name | (4-chloronaphthalen-1-yl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
|---|---|
| PubChem CID | 7920028 |
| Molecular Formula | C19H13ClO4 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | (4-chloronaphthalen-1-yl) 2,3-dihydro-1,4-benzodioxine-6-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)c2ccccc12)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H13ClO4/c20-15-6-8-16(14-4-2-1-3-13(14)15)24-19(21)12-5-7-17-18(11-12)23-10-9-22-17/h1-8,11H,9-10H2 |
| InChIKey | GEIJBOBUBWMJQC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|