C27H31NO8 — CID 101451112
(3-aminonaphthalen-2-yl) 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylate (PubChem CID 101451112) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is (3-aminonaphthalen-2-yl) 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylate.
| Compound Name | (3-aminonaphthalen-2-yl) 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylate |
|---|---|
| PubChem CID | 101451112 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (3-aminonaphthalen-2-yl) 2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(18),19,21-triene-20-carboxylate |
| SMILES | Nc1cc2ccccc2cc1OC(=O)c1ccc2c(c1)OCCOCCOCCOCCOCCO2 |
| InChI | InChI=1S/C27H31NO8/c28-23-17-20-3-1-2-4-21(20)18-25(23)36-27(29)22-5-6-24-26(19-22)35-16-14-33-12-10-31-8-7-30-9-11-32-13-15-34-24/h1-6,17-19H,7-16,28H2 |
| InChIKey | RSEJSCQLPBTKQX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|