C30H23N3O3S — CID 110492773
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 110492773) has the molecular formula C30H23N3O3S and a molecular weight of 505.60 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 110492773 |
| Molecular Formula | C30H23N3O3S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] (E)-3-(3-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(OCc2ccccc2)c1)Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C30H23N3O3S/c34-29(16-15-22-10-6-12-25(18-22)35-20-23-8-2-1-3-9-23)36-26-13-7-11-24(19-26)32-30-33-28(21-37-30)27-14-4-5-17-31-27/h1-19,21H,20H2,(H,32,33)/b16-15+ |
| InChIKey | BBITWIPGFITDOE-FOCLMDBBSA-N |
| XLogP | 7.15 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|