C21H16N4O2S — CID 110492702
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] N-phenylcarbamate (PubChem CID 110492702) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] N-phenylcarbamate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 110492702 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C21H16N4O2S/c26-21(24-15-7-2-1-3-8-15)27-17-10-6-9-16(13-17)23-20-25-19(14-28-20)18-11-4-5-12-22-18/h1-14H,(H,23,25)(H,24,26) |
| InChIKey | RREUFRBRQGVEJE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |