C18H15N3O2S — CID 110492662
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] cyclopropanecarboxylate (PubChem CID 110492662) has the molecular formula C18H15N3O2S and a molecular weight of 337.40 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] cyclopropanecarboxylate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 110492662 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] cyclopropanecarboxylate |
| SMILES | O=C(Oc1cccc(Nc2nc(-c3ccccn3)cs2)c1)C1CC1 |
| InChI | InChI=1S/C18H15N3O2S/c22-17(12-7-8-12)23-14-5-3-4-13(10-14)20-18-21-16(11-24-18)15-6-1-2-9-19-15/h1-6,9-12H,7-8H2,(H,20,21) |
| InChIKey | DPAUKAWKCZNOTQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|