C22H19N3O3S2 — CID 110504056
[3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,4-dimethylbenzenesulfonate (PubChem CID 110504056) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,4-dimethylbenzenesulfonate.
| Compound Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,4-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 110504056 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [3-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]phenyl] 3,4-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(Nc3nc(-c4ccccn4)cs3)c2)cc1C |
| InChI | InChI=1S/C22H19N3O3S2/c1-15-9-10-19(12-16(15)2)30(26,27)28-18-7-5-6-17(13-18)24-22-25-21(14-29-22)20-8-3-4-11-23-20/h3-14H,1-2H3,(H,24,25) |
| InChIKey | FDRWKFUMTOKWIW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|